C21H23NO2S2 — CID 18933915
2-methylsulfanyl-5-[6-(4-methylsulfonylphenyl)spiro[3.4]oct-6-en-7-yl]pyridine (PubChem CID 18933915) has the molecular formula C21H23NO2S2 and a molecular weight of 385.55 g/mol. Its IUPAC name is 2-methylsulfanyl-5-[6-(4-methylsulfonylphenyl)spiro[3.4]oct-6-en-7-yl]pyridine.
| Compound Name | 2-methylsulfanyl-5-[6-(4-methylsulfonylphenyl)spiro[3.4]oct-6-en-7-yl]pyridine |
|---|---|
| PubChem CID | 18933915 |
| Molecular Formula | C21H23NO2S2 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 2-methylsulfanyl-5-[6-(4-methylsulfonylphenyl)spiro[3.4]oct-6-en-7-yl]pyridine |
| SMILES | CSc1ccc(C2=C(c3ccc(S(C)(=O)=O)cc3)CC3(CCC3)C2)cn1 |
| InChI | InChI=1S/C21H23NO2S2/c1-25-20-9-6-16(14-22-20)19-13-21(10-3-11-21)12-18(19)15-4-7-17(8-5-15)26(2,23)24/h4-9,14H,3,10-13H2,1-2H3 |
| InChIKey | YFJBWQHJZREURI-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |