C20H19IO2S — CID 18933968
6-(4-iodophenyl)-5-(4-methylsulfonylphenyl)spiro[2.4]hept-5-ene (PubChem CID 18933968) has the molecular formula C20H19IO2S and a molecular weight of 450.34 g/mol. Its IUPAC name is 6-(4-iodophenyl)-5-(4-methylsulfonylphenyl)spiro[2.4]hept-5-ene.
| Compound Name | 6-(4-iodophenyl)-5-(4-methylsulfonylphenyl)spiro[2.4]hept-5-ene |
|---|---|
| PubChem CID | 18933968 |
| Molecular Formula | C20H19IO2S |
| Molecular Weight | 450.34 g/mol |
| Exact Mass | 450.02 |
| IUPAC Name | 6-(4-iodophenyl)-5-(4-methylsulfonylphenyl)spiro[2.4]hept-5-ene |
| SMILES | CS(=O)(=O)c1ccc(C2=C(c3ccc(I)cc3)CC3(CC3)C2)cc1 |
| InChI | InChI=1S/C20H19IO2S/c1-24(22,23)17-8-4-15(5-9-17)19-13-20(10-11-20)12-18(19)14-2-6-16(21)7-3-14/h2-9H,10-13H2,1H3 |
| InChIKey | BZJCRMFNKRMRBF-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.34 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|