C22H25NO2S — CID 67570933
N,N-dimethyl-4-[6-(4-methylsulfonylphenyl)spiro[2.4]hept-5-en-5-yl]aniline (PubChem CID 67570933) has the molecular formula C22H25NO2S and a molecular weight of 367.51 g/mol. Its IUPAC name is N,N-dimethyl-4-[6-(4-methylsulfonylphenyl)spiro[2.4]hept-5-en-5-yl]aniline.
| Compound Name | N,N-dimethyl-4-[6-(4-methylsulfonylphenyl)spiro[2.4]hept-5-en-5-yl]aniline |
|---|---|
| PubChem CID | 67570933 |
| Molecular Formula | C22H25NO2S |
| Molecular Weight | 367.51 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | N,N-dimethyl-4-[6-(4-methylsulfonylphenyl)spiro[2.4]hept-5-en-5-yl]aniline |
| SMILES | CN(C)c1ccc(C2=C(c3ccc(S(C)(=O)=O)cc3)CC3(CC3)C2)cc1 |
| InChI | InChI=1S/C22H25NO2S/c1-23(2)18-8-4-16(5-9-18)20-14-22(12-13-22)15-21(20)17-6-10-19(11-7-17)26(3,24)25/h4-11H,12-15H2,1-3H3 |
| InChIKey | FORJPVUOMXJHOI-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.51 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|