C19H18ClNO2S — CID 18934071
2-[5-(4-chlorophenyl)spiro[2.4]hept-5-en-6-yl]-5-methylsulfonylpyridine (PubChem CID 18934071) has the molecular formula C19H18ClNO2S and a molecular weight of 359.88 g/mol. Its IUPAC name is 2-[5-(4-chlorophenyl)spiro[2.4]hept-5-en-6-yl]-5-methylsulfonylpyridine.
| Compound Name | 2-[5-(4-chlorophenyl)spiro[2.4]hept-5-en-6-yl]-5-methylsulfonylpyridine |
|---|---|
| PubChem CID | 18934071 |
| Molecular Formula | C19H18ClNO2S |
| Molecular Weight | 359.88 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 2-[5-(4-chlorophenyl)spiro[2.4]hept-5-en-6-yl]-5-methylsulfonylpyridine |
| SMILES | CS(=O)(=O)c1ccc(C2=C(c3ccc(Cl)cc3)CC3(CC3)C2)nc1 |
| InChI | InChI=1S/C19H18ClNO2S/c1-24(22,23)15-6-7-18(21-12-15)17-11-19(8-9-19)10-16(17)13-2-4-14(20)5-3-13/h2-7,12H,8-11H2,1H3 |
| InChIKey | WBFJMLNAUPTPBB-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.88 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |