C21H26Cl2O3S — CID 59981648
5-(3,5-dichloro-4-methoxycyclohexyl)-6-(4-methylsulfonylphenyl)spiro[2.4]hept-5-ene (PubChem CID 59981648) has the molecular formula C21H26Cl2O3S and a molecular weight of 429.41 g/mol. Its IUPAC name is 5-(3,5-dichloro-4-methoxycyclohexyl)-6-(4-methylsulfonylphenyl)spiro[2.4]hept-5-ene.
| Compound Name | 5-(3,5-dichloro-4-methoxycyclohexyl)-6-(4-methylsulfonylphenyl)spiro[2.4]hept-5-ene |
|---|---|
| PubChem CID | 59981648 |
| Molecular Formula | C21H26Cl2O3S |
| Molecular Weight | 429.41 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | 5-(3,5-dichloro-4-methoxycyclohexyl)-6-(4-methylsulfonylphenyl)spiro[2.4]hept-5-ene |
| SMILES | COC1C(Cl)CC(C2=C(c3ccc(S(C)(=O)=O)cc3)CC3(CC3)C2)CC1Cl |
| InChI | InChI=1S/C21H26Cl2O3S/c1-26-20-18(22)9-14(10-19(20)23)17-12-21(7-8-21)11-16(17)13-3-5-15(6-4-13)27(2,24)25/h3-6,14,18-20H,7-12H2,1-2H3 |
| InChIKey | FPBAGQKJCDOCQR-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.41 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|