C22H22N2O2S — CID 18933720
4-[3-(6-methylsulfonyl-3-pyridinyl)spiro[4.4]non-2-en-2-yl]benzonitrile (PubChem CID 18933720) has the molecular formula C22H22N2O2S and a molecular weight of 378.50 g/mol. Its IUPAC name is 4-[3-(6-methylsulfonyl-3-pyridinyl)spiro[4.4]non-2-en-2-yl]benzonitrile.
| Compound Name | 4-[3-(6-methylsulfonyl-3-pyridinyl)spiro[4.4]non-2-en-2-yl]benzonitrile |
|---|---|
| PubChem CID | 18933720 |
| Molecular Formula | C22H22N2O2S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 4-[3-(6-methylsulfonyl-3-pyridinyl)spiro[4.4]non-2-en-2-yl]benzonitrile |
| SMILES | CS(=O)(=O)c1ccc(C2=C(c3ccc(C#N)cc3)CC3(CCCC3)C2)cn1 |
| InChI | InChI=1S/C22H22N2O2S/c1-27(25,26)21-9-8-18(15-24-21)20-13-22(10-2-3-11-22)12-19(20)17-6-4-16(14-23)5-7-17/h4-9,15H,2-3,10-13H2,1H3 |
| InChIKey | YWORCVRMSCWRCS-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 70.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |