C17H15N3O2S — CID 22917300
5-[2-(4-cyanophenyl)cyclopenten-1-yl]pyridine-2-sulfonamide (PubChem CID 22917300) has the molecular formula C17H15N3O2S and a molecular weight of 325.39 g/mol. Its IUPAC name is 5-[2-(4-cyanophenyl)cyclopenten-1-yl]pyridine-2-sulfonamide.
| Compound Name | 5-[2-(4-cyanophenyl)cyclopenten-1-yl]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 22917300 |
| Molecular Formula | C17H15N3O2S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 5-[2-(4-cyanophenyl)cyclopenten-1-yl]pyridine-2-sulfonamide |
| SMILES | N#Cc1ccc(C2=C(c3ccc(S(N)(=O)=O)nc3)CCC2)cc1 |
| InChI | InChI=1S/C17H15N3O2S/c18-10-12-4-6-13(7-5-12)15-2-1-3-16(15)14-8-9-17(20-11-14)23(19,21)22/h4-9,11H,1-3H2,(H2,19,21,22) |
| InChIKey | GNTQZAAYXBIGJJ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 96.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |