C17H14F4N2O2S — CID 22917315
5-[2-(4-fluorophenyl)-4-(trifluoromethyl)cyclopenten-1-yl]pyridine-2-sulfonamide (PubChem CID 22917315) has the molecular formula C17H14F4N2O2S and a molecular weight of 386.37 g/mol. Its IUPAC name is 5-[2-(4-fluorophenyl)-4-(trifluoromethyl)cyclopenten-1-yl]pyridine-2-sulfonamide.
| Compound Name | 5-[2-(4-fluorophenyl)-4-(trifluoromethyl)cyclopenten-1-yl]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 22917315 |
| Molecular Formula | C17H14F4N2O2S |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | 5-[2-(4-fluorophenyl)-4-(trifluoromethyl)cyclopenten-1-yl]pyridine-2-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc(C2=C(c3ccc(F)cc3)CC(C(F)(F)F)C2)cn1 |
| InChI | InChI=1S/C17H14F4N2O2S/c18-13-4-1-10(2-5-13)14-7-12(17(19,20)21)8-15(14)11-3-6-16(23-9-11)26(22,24)25/h1-6,9,12H,7-8H2,(H2,22,24,25) |
| InChIKey | GGJRICNFMXZNQO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |