About 6-[4,4-diethyl-2-(4-fluorophenyl)cyclopenten-1-yl]pyridine-3-sulfonamide
6-[4,4-diethyl-2-(4-fluorophenyl)cyclopenten-1-yl]pyridine-3-sulfonamide (PubChem CID 22917458) has the molecular formula C20H23FN2O2S
and a molecular weight of 374.48 g/mol. Its IUPAC name is 6-[4,4-diethyl-2-(4-fluorophenyl)cyclopenten-1-yl]pyridine-3-sulfonamide.
Molecular Properties
| Compound Name | 6-[4,4-diethyl-2-(4-fluorophenyl)cyclopenten-1-yl]pyridine-3-sulfonamide |
| PubChem CID | 22917458 |
| Molecular Formula | C20H23FN2O2S |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 6-[4,4-diethyl-2-(4-fluorophenyl)cyclopenten-1-yl]pyridine-3-sulfonamide |
| SMILES | CCC1(CC)CC(c2ccc(F)cc2)=C(c2ccc(S(N)(=O)=O)cn2)C1 |
| InChI | InChI=1S/C20H23FN2O2S/c1-3-20(4-2)11-17(14-5-7-15(21)8-6-14)18(12-20)19-10-9-16(13-23-19)26(22,24)25/h5-10,13H,3-4,11-12H2,1-2H3,(H2,22,24,25) |
| InChIKey | FCPZFYDCCOIJRB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[4,4-diethyl-2-(4-fluorophenyl)cyclopenten-1-yl]pyridine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4,4-diethyl-2-(4-fluorophenyl)cyclopenten-1-yl]pyridine-3-sulfonamide?
The IUPAC name of 6-[4,4-diethyl-2-(4-fluorophenyl)cyclopenten-1-yl]pyridine-3-sulfonamide (CID 22917458) is 6-[4,4-diethyl-2-(4-fluorophenyl)cyclopenten-1-yl]pyridine-3-sulfonamide.
What is the SMILES notation for 6-[4,4-diethyl-2-(4-fluorophenyl)cyclopenten-1-yl]pyridine-3-sulfonamide?
The canonical SMILES for 6-[4,4-diethyl-2-(4-fluorophenyl)cyclopenten-1-yl]pyridine-3-sulfonamide is CCC1(CC)CC(c2ccc(F)cc2)=C(c2ccc(S(N)(=O)=O)cn2)C1.
What is the InChIKey of 6-[4,4-diethyl-2-(4-fluorophenyl)cyclopenten-1-yl]pyridine-3-sulfonamide?
The InChIKey is FCPZFYDCCOIJRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23FN2O2S/c1-3-20(4-2)11-17(14-5-7-15(21)8-6-14)18(12-20)19-10-9-16(13-23-19)26(22,24)25/h5-10,13H,3-4,11-12H2,1-2H3,(H2,22,24,25).
What are the key properties of 6-[4,4-diethyl-2-(4-fluorophenyl)cyclopenten-1-yl]pyridine-3-sulfonamide?
6-[4,4-diethyl-2-(4-fluorophenyl)cyclopenten-1-yl]pyridine-3-sulfonamide has a molecular weight of 374.48 g/mol, XLogP of 4.38, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4,4-diethyl-2-(4-fluorophenyl)cyclopenten-1-yl]pyridine-3-sulfonamide is sourced from PubChem (CID 22917458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).