C20H20FNO4S — CID 23288242
4-[2,2-diethyl-4-(4-fluorophenyl)-5-oxofuran-3-yl]benzenesulfonamide (PubChem CID 23288242) has the molecular formula C20H20FNO4S and a molecular weight of 389.45 g/mol. Its IUPAC name is 4-[2,2-diethyl-4-(4-fluorophenyl)-5-oxofuran-3-yl]benzenesulfonamide.
| Compound Name | 4-[2,2-diethyl-4-(4-fluorophenyl)-5-oxofuran-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 23288242 |
| Molecular Formula | C20H20FNO4S |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 4-[2,2-diethyl-4-(4-fluorophenyl)-5-oxofuran-3-yl]benzenesulfonamide |
| SMILES | CCC1(CC)OC(=O)C(c2ccc(F)cc2)=C1c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C20H20FNO4S/c1-3-20(4-2)18(14-7-11-16(12-8-14)27(22,24)25)17(19(23)26-20)13-5-9-15(21)10-6-13/h5-12H,3-4H2,1-2H3,(H2,22,24,25) |
| InChIKey | AQCZCBRFLRPYMD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|