C18H16ClNO4S — CID 142769920
4-[2-(4-chlorophenyl)-5,5-dimethyl-4-oxofuran-3-yl]benzenesulfonamide (PubChem CID 142769920) has the molecular formula C18H16ClNO4S and a molecular weight of 377.85 g/mol. Its IUPAC name is 4-[2-(4-chlorophenyl)-5,5-dimethyl-4-oxofuran-3-yl]benzenesulfonamide.
| Compound Name | 4-[2-(4-chlorophenyl)-5,5-dimethyl-4-oxofuran-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 142769920 |
| Molecular Formula | C18H16ClNO4S |
| Molecular Weight | 377.85 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | 4-[2-(4-chlorophenyl)-5,5-dimethyl-4-oxofuran-3-yl]benzenesulfonamide |
| SMILES | CC1(C)OC(c2ccc(Cl)cc2)=C(c2ccc(S(N)(=O)=O)cc2)C1=O |
| InChI | InChI=1S/C18H16ClNO4S/c1-18(2)17(21)15(11-5-9-14(10-6-11)25(20,22)23)16(24-18)12-3-7-13(19)8-4-12/h3-10H,1-2H3,(H2,20,22,23) |
| InChIKey | VUTPKYRGIJXNPX-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.85 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|