C18H15Cl2NO4S — CID 18386126
2-chloro-4-[3-(3-chlorophenyl)-5,5-dimethyl-4-oxofuran-2-yl]benzenesulfonamide (PubChem CID 18386126) has the molecular formula C18H15Cl2NO4S and a molecular weight of 412.29 g/mol. Its IUPAC name is 2-chloro-4-[3-(3-chlorophenyl)-5,5-dimethyl-4-oxofuran-2-yl]benzenesulfonamide.
| Compound Name | 2-chloro-4-[3-(3-chlorophenyl)-5,5-dimethyl-4-oxofuran-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 18386126 |
| Molecular Formula | C18H15Cl2NO4S |
| Molecular Weight | 412.29 g/mol |
| Exact Mass | 411.01 |
| IUPAC Name | 2-chloro-4-[3-(3-chlorophenyl)-5,5-dimethyl-4-oxofuran-2-yl]benzenesulfonamide |
| SMILES | CC1(C)OC(c2ccc(S(N)(=O)=O)c(Cl)c2)=C(c2cccc(Cl)c2)C1=O |
| InChI | InChI=1S/C18H15Cl2NO4S/c1-18(2)17(22)15(10-4-3-5-12(19)8-10)16(25-18)11-6-7-14(13(20)9-11)26(21,23)24/h3-9H,1-2H3,(H2,21,23,24) |
| InChIKey | CXMIAGJIAVOBCZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.29 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|