C19H15F3O4S — CID 18385676
4-(2,6-difluorophenyl)-5-(3-fluoro-4-methylsulfonylphenyl)-2,2-dimethylfuran-3-one (PubChem CID 18385676) has the molecular formula C19H15F3O4S and a molecular weight of 396.39 g/mol. Its IUPAC name is 4-(2,6-difluorophenyl)-5-(3-fluoro-4-methylsulfonylphenyl)-2,2-dimethylfuran-3-one.
| Compound Name | 4-(2,6-difluorophenyl)-5-(3-fluoro-4-methylsulfonylphenyl)-2,2-dimethylfuran-3-one |
|---|---|
| PubChem CID | 18385676 |
| Molecular Formula | C19H15F3O4S |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | 4-(2,6-difluorophenyl)-5-(3-fluoro-4-methylsulfonylphenyl)-2,2-dimethylfuran-3-one |
| SMILES | CC1(C)OC(c2ccc(S(C)(=O)=O)c(F)c2)=C(c2c(F)cccc2F)C1=O |
| InChI | InChI=1S/C19H15F3O4S/c1-19(2)18(23)16(15-11(20)5-4-6-12(15)21)17(26-19)10-7-8-14(13(22)9-10)27(3,24)25/h4-9H,1-3H3 |
| InChIKey | OUBIHSDQGOZVGR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|