C21H22O4S — CID 18386117
4-(3,4-dimethylphenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one (PubChem CID 18386117) has the molecular formula C21H22O4S and a molecular weight of 370.47 g/mol. Its IUPAC name is 4-(3,4-dimethylphenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one.
| Compound Name | 4-(3,4-dimethylphenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one |
|---|---|
| PubChem CID | 18386117 |
| Molecular Formula | C21H22O4S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 4-(3,4-dimethylphenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one |
| SMILES | Cc1ccc(C2=C(c3ccc(S(C)(=O)=O)cc3)OC(C)(C)C2=O)cc1C |
| InChI | InChI=1S/C21H22O4S/c1-13-6-7-16(12-14(13)2)18-19(25-21(3,4)20(18)22)15-8-10-17(11-9-15)26(5,23)24/h6-12H,1-5H3 |
| InChIKey | UWPJBGBXELOFQL-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|