C13H13BrO4S — CID 18385727
4-bromo-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one (PubChem CID 18385727) has the molecular formula C13H13BrO4S and a molecular weight of 345.21 g/mol. Its IUPAC name is 4-bromo-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one.
| Compound Name | 4-bromo-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one |
|---|---|
| PubChem CID | 18385727 |
| Molecular Formula | C13H13BrO4S |
| Molecular Weight | 345.21 g/mol |
| Exact Mass | 343.97 |
| IUPAC Name | 4-bromo-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one |
| SMILES | CC1(C)OC(c2ccc(S(C)(=O)=O)cc2)=C(Br)C1=O |
| InChI | InChI=1S/C13H13BrO4S/c1-13(2)12(15)10(14)11(18-13)8-4-6-9(7-5-8)19(3,16)17/h4-7H,1-3H3 |
| InChIKey | ZMHQTZLKBMAMKU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.21 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|