C19H17BrO3 — CID 59354846
4-bromo-2,2-dimethyl-5-(4-phenylmethoxyphenyl)furan-3-one (PubChem CID 59354846) has the molecular formula C19H17BrO3 and a molecular weight of 373.25 g/mol. Its IUPAC name is 4-bromo-2,2-dimethyl-5-(4-phenylmethoxyphenyl)furan-3-one.
| Compound Name | 4-bromo-2,2-dimethyl-5-(4-phenylmethoxyphenyl)furan-3-one |
|---|---|
| PubChem CID | 59354846 |
| Molecular Formula | C19H17BrO3 |
| Molecular Weight | 373.25 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | 4-bromo-2,2-dimethyl-5-(4-phenylmethoxyphenyl)furan-3-one |
| SMILES | CC1(C)OC(c2ccc(OCc3ccccc3)cc2)=C(Br)C1=O |
| InChI | InChI=1S/C19H17BrO3/c1-19(2)18(21)16(20)17(23-19)14-8-10-15(11-9-14)22-12-13-6-4-3-5-7-13/h3-11H,12H2,1-2H3 |
| InChIKey | DHBGJCKACYLBNF-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.25 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|