C19H17NO2 — CID 169490402
3-methyl-5-(4-phenylmethoxyphenyl)-1H-pyridin-2-one (PubChem CID 169490402) has the molecular formula C19H17NO2 and a molecular weight of 291.35 g/mol. Its IUPAC name is 3-methyl-5-(4-phenylmethoxyphenyl)-1H-pyridin-2-one.
| Compound Name | 3-methyl-5-(4-phenylmethoxyphenyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 169490402 |
| Molecular Formula | C19H17NO2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 3-methyl-5-(4-phenylmethoxyphenyl)-1H-pyridin-2-one |
| SMILES | Cc1cc(-c2ccc(OCc3ccccc3)cc2)c[nH]c1=O |
| InChI | InChI=1S/C19H17NO2/c1-14-11-17(12-20-19(14)21)16-7-9-18(10-8-16)22-13-15-5-3-2-4-6-15/h2-12H,13H2,1H3,(H,20,21) |
| InChIKey | VOFOUEJGNNCGSP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |