C31H26O2 — CID 70041760
1,3-diphenylbenzene;4-phenylmethoxyphenol (PubChem CID 70041760) has the molecular formula C31H26O2 and a molecular weight of 430.55 g/mol. Its IUPAC name is 1,3-diphenylbenzene;4-phenylmethoxyphenol.
| Compound Name | 1,3-diphenylbenzene;4-phenylmethoxyphenol |
|---|---|
| PubChem CID | 70041760 |
| Molecular Formula | C31H26O2 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 1,3-diphenylbenzene;4-phenylmethoxyphenol |
| SMILES | Oc1ccc(OCc2ccccc2)cc1.c1ccc(-c2cccc(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C18H14.C13H12O2/c1-3-8-15(9-4-1)17-12-7-13-18(14-17)16-10-5-2-6-11-16;14-12-6-8-13(9-7-12)15-10-11-4-2-1-3-5-11/h1-14H;1-9,14H,10H2 |
| InChIKey | YUAGKIKCWFFAIP-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |