About phenoxymethylbenzene;2-phenylphenol
phenoxymethylbenzene;2-phenylphenol (PubChem CID 159234068) has the molecular formula C25H22O2
and a molecular weight of 354.45 g/mol. Its IUPAC name is phenoxymethylbenzene;2-phenylphenol.
Molecular Properties
| Compound Name | phenoxymethylbenzene;2-phenylphenol |
| PubChem CID | 159234068 |
| Molecular Formula | C25H22O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | phenoxymethylbenzene;2-phenylphenol |
| SMILES | Oc1ccccc1-c1ccccc1.c1ccc(COc2ccccc2)cc1 |
| InChI | InChI=1S/C13H12O.C12H10O/c1-3-7-12(8-4-1)11-14-13-9-5-2-6-10-13;13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-10H,11H2;1-9,13H |
| InChIKey | KTGFZSUZFQQTII-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze phenoxymethylbenzene;2-phenylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenoxymethylbenzene;2-phenylphenol?
The IUPAC name of phenoxymethylbenzene;2-phenylphenol (CID 159234068) is phenoxymethylbenzene;2-phenylphenol.
What is the SMILES notation for phenoxymethylbenzene;2-phenylphenol?
The canonical SMILES for phenoxymethylbenzene;2-phenylphenol is Oc1ccccc1-c1ccccc1.c1ccc(COc2ccccc2)cc1.
What is the InChIKey of phenoxymethylbenzene;2-phenylphenol?
The InChIKey is KTGFZSUZFQQTII-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O.C12H10O/c1-3-7-12(8-4-1)11-14-13-9-5-2-6-10-13;13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-10H,11H2;1-9,13H.
What are the key properties of phenoxymethylbenzene;2-phenylphenol?
phenoxymethylbenzene;2-phenylphenol has a molecular weight of 354.45 g/mol, XLogP of 6.32, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenoxymethylbenzene;2-phenylphenol is sourced from PubChem (CID 159234068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).