About carbanide;2-phenylphenol;titanium(3+)
carbanide;2-phenylphenol;titanium(3+) (PubChem CID 59317555) has the molecular formula C15H19OTi
and a molecular weight of 263.18 g/mol. Its IUPAC name is carbanide;2-phenylphenol;titanium(3+).
Molecular Properties
| Compound Name | carbanide;2-phenylphenol;titanium(3+) |
| PubChem CID | 59317555 |
| Molecular Formula | C15H19OTi |
| Molecular Weight | 263.18 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | carbanide;2-phenylphenol;titanium(3+) |
| SMILES | Oc1ccccc1-c1ccccc1.[CH3-].[CH3-].[CH3-].[Ti+3] |
| InChI | InChI=1S/C12H10O.3CH3.Ti/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;;;;/h1-9,13H;3*1H3;/q;3*-1;+3 |
| InChIKey | VREQZXFWOYMQBT-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.18 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;2-phenylphenol;titanium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;2-phenylphenol;titanium(3+)?
The IUPAC name of carbanide;2-phenylphenol;titanium(3+) (CID 59317555) is carbanide;2-phenylphenol;titanium(3+).
What is the SMILES notation for carbanide;2-phenylphenol;titanium(3+)?
The canonical SMILES for carbanide;2-phenylphenol;titanium(3+) is Oc1ccccc1-c1ccccc1.[CH3-].[CH3-].[CH3-].[Ti+3].
What is the InChIKey of carbanide;2-phenylphenol;titanium(3+)?
The InChIKey is VREQZXFWOYMQBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O.3CH3.Ti/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;;;;/h1-9,13H;3*1H3;/q;3*-1;+3.
What are the key properties of carbanide;2-phenylphenol;titanium(3+)?
carbanide;2-phenylphenol;titanium(3+) has a molecular weight of 263.18 g/mol, XLogP of 4.41, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;2-phenylphenol;titanium(3+) is sourced from PubChem (CID 59317555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).