About sodium;hydrogen carbonate;2-phenylphenol
sodium;hydrogen carbonate;2-phenylphenol (PubChem CID 175078237) has the molecular formula C13H11NaO4
and a molecular weight of 254.22 g/mol. Its IUPAC name is sodium;hydrogen carbonate;2-phenylphenol.
Molecular Properties
| Compound Name | sodium;hydrogen carbonate;2-phenylphenol |
| PubChem CID | 175078237 |
| Molecular Formula | C13H11NaO4 |
| Molecular Weight | 254.22 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | sodium;hydrogen carbonate;2-phenylphenol |
| SMILES | O=C([O-])O.Oc1ccccc1-c1ccccc1.[Na+] |
| InChI | InChI=1S/C12H10O.CH2O3.Na/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;2-1(3)4;/h1-9,13H;(H2,2,3,4);/q;;+1/p-1 |
| InChIKey | YINGAKPXLXEVGH-UHFFFAOYSA-M |
| XLogP | -1.05 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.22 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze sodium;hydrogen carbonate;2-phenylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydrogen carbonate;2-phenylphenol?
The IUPAC name of sodium;hydrogen carbonate;2-phenylphenol (CID 175078237) is sodium;hydrogen carbonate;2-phenylphenol.
What is the SMILES notation for sodium;hydrogen carbonate;2-phenylphenol?
The canonical SMILES for sodium;hydrogen carbonate;2-phenylphenol is O=C([O-])O.Oc1ccccc1-c1ccccc1.[Na+].
What is the InChIKey of sodium;hydrogen carbonate;2-phenylphenol?
The InChIKey is YINGAKPXLXEVGH-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H10O.CH2O3.Na/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;2-1(3)4;/h1-9,13H;(H2,2,3,4);/q;;+1/p-1.
What are the key properties of sodium;hydrogen carbonate;2-phenylphenol?
sodium;hydrogen carbonate;2-phenylphenol has a molecular weight of 254.22 g/mol, XLogP of -1.05, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydrogen carbonate;2-phenylphenol is sourced from PubChem (CID 175078237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).