About disodium;hydrogen carbonate;2-phenylphenolate
disodium;hydrogen carbonate;2-phenylphenolate (PubChem CID 159083163) has the molecular formula C13H10Na2O4
and a molecular weight of 276.20 g/mol. Its IUPAC name is disodium;hydrogen carbonate;2-phenylphenolate.
Molecular Properties
| Compound Name | disodium;hydrogen carbonate;2-phenylphenolate |
| PubChem CID | 159083163 |
| Molecular Formula | C13H10Na2O4 |
| Molecular Weight | 276.20 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | disodium;hydrogen carbonate;2-phenylphenolate |
| SMILES | O=C([O-])O.[Na+].[Na+].[O-]c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C12H10O.CH2O3.2Na/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;2-1(3)4;;/h1-9,13H;(H2,2,3,4);;/q;;2*+1/p-2 |
| InChIKey | GTDSVKOQPIWEFZ-UHFFFAOYSA-L |
| XLogP | -4.68 |
| TPSA | 83.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.20 |
| LogP ≤ 5 | -4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze disodium;hydrogen carbonate;2-phenylphenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;hydrogen carbonate;2-phenylphenolate?
The IUPAC name of disodium;hydrogen carbonate;2-phenylphenolate (CID 159083163) is disodium;hydrogen carbonate;2-phenylphenolate.
What is the SMILES notation for disodium;hydrogen carbonate;2-phenylphenolate?
The canonical SMILES for disodium;hydrogen carbonate;2-phenylphenolate is O=C([O-])O.[Na+].[Na+].[O-]c1ccccc1-c1ccccc1.
What is the InChIKey of disodium;hydrogen carbonate;2-phenylphenolate?
The InChIKey is GTDSVKOQPIWEFZ-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H10O.CH2O3.2Na/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;2-1(3)4;;/h1-9,13H;(H2,2,3,4);;/q;;2*+1/p-2.
What are the key properties of disodium;hydrogen carbonate;2-phenylphenolate?
disodium;hydrogen carbonate;2-phenylphenolate has a molecular weight of 276.20 g/mol, XLogP of -4.68, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;hydrogen carbonate;2-phenylphenolate is sourced from PubChem (CID 159083163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).