About copper bis(2-phenylphenolate)
copper bis(2-phenylphenolate) (PubChem CID 69349474) has the molecular formula C24H18CuO2
and a molecular weight of 401.95 g/mol. Its IUPAC name is copper bis(2-phenylphenolate).
Molecular Properties
| Compound Name | copper bis(2-phenylphenolate) |
| PubChem CID | 69349474 |
| Molecular Formula | C24H18CuO2 |
| Molecular Weight | 401.95 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | copper bis(2-phenylphenolate) |
| SMILES | [Cu+2].[O-]c1ccccc1-c1ccccc1.[O-]c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/2C12H10O.Cu/c2*13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;/h2*1-9,13H;/q;;+2/p-2 |
| InChIKey | KMYJELLPFCPNEE-UHFFFAOYSA-L |
| XLogP | 4.85 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.95 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze copper bis(2-phenylphenolate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper bis(2-phenylphenolate)?
The IUPAC name of copper bis(2-phenylphenolate) (CID 69349474) is copper bis(2-phenylphenolate).
What is the SMILES notation for copper bis(2-phenylphenolate)?
The canonical SMILES for copper bis(2-phenylphenolate) is [Cu+2].[O-]c1ccccc1-c1ccccc1.[O-]c1ccccc1-c1ccccc1.
What is the InChIKey of copper bis(2-phenylphenolate)?
The InChIKey is KMYJELLPFCPNEE-UHFFFAOYSA-L. The full InChI is InChI=1S/2C12H10O.Cu/c2*13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;/h2*1-9,13H;/q;;+2/p-2.
What are the key properties of copper bis(2-phenylphenolate)?
copper bis(2-phenylphenolate) has a molecular weight of 401.95 g/mol, XLogP of 4.85, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for copper bis(2-phenylphenolate) is sourced from PubChem (CID 69349474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).