About zinc;2,6-diphenylphenolate;ethane
zinc;2,6-diphenylphenolate;ethane (PubChem CID 160596418) has the molecular formula C20H18OZn
and a molecular weight of 339.75 g/mol. Its IUPAC name is zinc;2,6-diphenylphenolate;ethane.
Molecular Properties
| Compound Name | zinc;2,6-diphenylphenolate;ethane |
| PubChem CID | 160596418 |
| Molecular Formula | C20H18OZn |
| Molecular Weight | 339.75 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | zinc;2,6-diphenylphenolate;ethane |
| SMILES | [CH2-]C.[O-]c1c(-c2ccccc2)cccc1-c1ccccc1.[Zn+2] |
| InChI | InChI=1S/C18H14O.C2H5.Zn/c19-18-16(14-8-3-1-4-9-14)12-7-13-17(18)15-10-5-2-6-11-15;1-2;/h1-13,19H;1H2,2H3;/q;-1;+2/p-1 |
| InChIKey | AXDMQRUSHRLHSC-UHFFFAOYSA-M |
| XLogP | 4.93 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.75 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc;2,6-diphenylphenolate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;2,6-diphenylphenolate;ethane?
The IUPAC name of zinc;2,6-diphenylphenolate;ethane (CID 160596418) is zinc;2,6-diphenylphenolate;ethane.
What is the SMILES notation for zinc;2,6-diphenylphenolate;ethane?
The canonical SMILES for zinc;2,6-diphenylphenolate;ethane is [CH2-]C.[O-]c1c(-c2ccccc2)cccc1-c1ccccc1.[Zn+2].
What is the InChIKey of zinc;2,6-diphenylphenolate;ethane?
The InChIKey is AXDMQRUSHRLHSC-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H14O.C2H5.Zn/c19-18-16(14-8-3-1-4-9-14)12-7-13-17(18)15-10-5-2-6-11-15;1-2;/h1-13,19H;1H2,2H3;/q;-1;+2/p-1.
What are the key properties of zinc;2,6-diphenylphenolate;ethane?
zinc;2,6-diphenylphenolate;ethane has a molecular weight of 339.75 g/mol, XLogP of 4.93, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;2,6-diphenylphenolate;ethane is sourced from PubChem (CID 160596418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).