C18H26 — CID 90738674
1,2-dimethyl-3-phenylbenzene;ethane (PubChem CID 90738674) has the molecular formula C18H26 and a molecular weight of 242.41 g/mol. Its IUPAC name is 1,2-dimethyl-3-phenylbenzene;ethane.
| Compound Name | 1,2-dimethyl-3-phenylbenzene;ethane |
|---|---|
| PubChem CID | 90738674 |
| Molecular Formula | C18H26 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 1,2-dimethyl-3-phenylbenzene;ethane |
| SMILES | CC.CC.Cc1cccc(-c2ccccc2)c1C |
| InChI | InChI=1S/C14H14.2C2H6/c1-11-7-6-10-14(12(11)2)13-8-4-3-5-9-13;2*1-2/h3-10H,1-2H3;2*1-2H3 |
| InChIKey | NQEFZHMOLMVMPK-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |