C19H19N — CID 175031313
azane;1-methyl-2,3-diphenylbenzene (PubChem CID 175031313) has the molecular formula C19H19N and a molecular weight of 261.37 g/mol. Its IUPAC name is azane;1-methyl-2,3-diphenylbenzene.
| Compound Name | azane;1-methyl-2,3-diphenylbenzene |
|---|---|
| PubChem CID | 175031313 |
| Molecular Formula | C19H19N |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | azane;1-methyl-2,3-diphenylbenzene |
| SMILES | Cc1cccc(-c2ccccc2)c1-c1ccccc1.N |
| InChI | InChI=1S/C19H16.H3N/c1-15-9-8-14-18(16-10-4-2-5-11-16)19(15)17-12-6-3-7-13-17;/h2-14H,1H3;1H3 |
| InChIKey | SZJRAMBJUWCFAU-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |