C19H18S — CID 174862423
1-methyl-2,3-diphenylbenzene;sulfane (PubChem CID 174862423) has the molecular formula C19H18S and a molecular weight of 278.42 g/mol. Its IUPAC name is 1-methyl-2,3-diphenylbenzene;sulfane.
| Compound Name | 1-methyl-2,3-diphenylbenzene;sulfane |
|---|---|
| PubChem CID | 174862423 |
| Molecular Formula | C19H18S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 1-methyl-2,3-diphenylbenzene;sulfane |
| SMILES | Cc1cccc(-c2ccccc2)c1-c1ccccc1.S |
| InChI | InChI=1S/C19H16.H2S/c1-15-9-8-14-18(16-10-4-2-5-11-16)19(15)17-12-6-3-7-13-17;/h2-14H,1H3;1H2 |
| InChIKey | MVGDSBMRPAJGPF-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |