C26H24 — CID 173440409
1,1'-biphenyl;1,2-dimethyl-3-phenylbenzene (PubChem CID 173440409) has the molecular formula C26H24 and a molecular weight of 336.48 g/mol. Its IUPAC name is 1,1'-biphenyl;1,2-dimethyl-3-phenylbenzene.
| Compound Name | 1,1'-biphenyl;1,2-dimethyl-3-phenylbenzene |
|---|---|
| PubChem CID | 173440409 |
| Molecular Formula | C26H24 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | 1,1'-biphenyl;1,2-dimethyl-3-phenylbenzene |
| SMILES | Cc1cccc(-c2ccccc2)c1C.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C14H14.C12H10/c1-11-7-6-10-14(12(11)2)13-8-4-3-5-9-13;1-3-7-11(8-4-1)12-9-5-2-6-10-12/h3-10H,1-2H3;1-10H |
| InChIKey | HOJVFYWEURNAAG-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |