C34H32O — CID 91366779
1,2-dimethyl-3-phenylbenzene;5-methoxy-2-methyl-1,3-diphenylbenzene (PubChem CID 91366779) has the molecular formula C34H32O and a molecular weight of 456.63 g/mol. Its IUPAC name is 1,2-dimethyl-3-phenylbenzene;5-methoxy-2-methyl-1,3-diphenylbenzene.
| Compound Name | 1,2-dimethyl-3-phenylbenzene;5-methoxy-2-methyl-1,3-diphenylbenzene |
|---|---|
| PubChem CID | 91366779 |
| Molecular Formula | C34H32O |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | 1,2-dimethyl-3-phenylbenzene;5-methoxy-2-methyl-1,3-diphenylbenzene |
| SMILES | COc1cc(-c2ccccc2)c(C)c(-c2ccccc2)c1.Cc1cccc(-c2ccccc2)c1C |
| InChI | InChI=1S/C20H18O.C14H14/c1-15-19(16-9-5-3-6-10-16)13-18(21-2)14-20(15)17-11-7-4-8-12-17;1-11-7-6-10-14(12(11)2)13-8-4-3-5-9-13/h3-14H,1-2H3;3-10H,1-2H3 |
| InChIKey | QXJGROQHYONGHD-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |