About 1,2-dimethyl-3-phenylbenzene;5-methoxy-2-methyl-1,3-diphenylbenzene
1,2-dimethyl-3-phenylbenzene;5-methoxy-2-methyl-1,3-diphenylbenzene (PubChem CID 91366779) has the molecular formula C34H32O
and a molecular weight of 456.63 g/mol. Its IUPAC name is 1,2-dimethyl-3-phenylbenzene;5-methoxy-2-methyl-1,3-diphenylbenzene.
Molecular Properties
| Compound Name | 1,2-dimethyl-3-phenylbenzene;5-methoxy-2-methyl-1,3-diphenylbenzene |
| PubChem CID | 91366779 |
| Molecular Formula | C34H32O |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | 1,2-dimethyl-3-phenylbenzene;5-methoxy-2-methyl-1,3-diphenylbenzene |
| SMILES | COc1cc(-c2ccccc2)c(C)c(-c2ccccc2)c1.Cc1cccc(-c2ccccc2)c1C |
| InChI | InChI=1S/C20H18O.C14H14/c1-15-19(16-9-5-3-6-10-16)13-18(21-2)14-20(15)17-11-7-4-8-12-17;1-11-7-6-10-14(12(11)2)13-8-4-3-5-9-13/h3-14H,1-2H3;3-10H,1-2H3 |
| InChIKey | QXJGROQHYONGHD-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,2-dimethyl-3-phenylbenzene;5-methoxy-2-methyl-1,3-diphenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethyl-3-phenylbenzene;5-methoxy-2-methyl-1,3-diphenylbenzene?
The IUPAC name of 1,2-dimethyl-3-phenylbenzene;5-methoxy-2-methyl-1,3-diphenylbenzene (CID 91366779) is 1,2-dimethyl-3-phenylbenzene;5-methoxy-2-methyl-1,3-diphenylbenzene.
What is the SMILES notation for 1,2-dimethyl-3-phenylbenzene;5-methoxy-2-methyl-1,3-diphenylbenzene?
The canonical SMILES for 1,2-dimethyl-3-phenylbenzene;5-methoxy-2-methyl-1,3-diphenylbenzene is COc1cc(-c2ccccc2)c(C)c(-c2ccccc2)c1.Cc1cccc(-c2ccccc2)c1C.
What is the InChIKey of 1,2-dimethyl-3-phenylbenzene;5-methoxy-2-methyl-1,3-diphenylbenzene?
The InChIKey is QXJGROQHYONGHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18O.C14H14/c1-15-19(16-9-5-3-6-10-16)13-18(21-2)14-20(15)17-11-7-4-8-12-17;1-11-7-6-10-14(12(11)2)13-8-4-3-5-9-13/h3-14H,1-2H3;3-10H,1-2H3.
What are the key properties of 1,2-dimethyl-3-phenylbenzene;5-methoxy-2-methyl-1,3-diphenylbenzene?
1,2-dimethyl-3-phenylbenzene;5-methoxy-2-methyl-1,3-diphenylbenzene has a molecular weight of 456.63 g/mol, XLogP of 9.31, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethyl-3-phenylbenzene;5-methoxy-2-methyl-1,3-diphenylbenzene is sourced from PubChem (CID 91366779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).