C15H13F3O — CID 57085724
1,2-dimethyl-3-[3-(trifluoromethoxy)phenyl]benzene (PubChem CID 57085724) has the molecular formula C15H13F3O and a molecular weight of 266.26 g/mol. Its IUPAC name is 1,2-dimethyl-3-[3-(trifluoromethoxy)phenyl]benzene.
| Compound Name | 1,2-dimethyl-3-[3-(trifluoromethoxy)phenyl]benzene |
|---|---|
| PubChem CID | 57085724 |
| Molecular Formula | C15H13F3O |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 1,2-dimethyl-3-[3-(trifluoromethoxy)phenyl]benzene |
| SMILES | Cc1cccc(-c2cccc(OC(F)(F)F)c2)c1C |
| InChI | InChI=1S/C15H13F3O/c1-10-5-3-8-14(11(10)2)12-6-4-7-13(9-12)19-15(16,17)18/h3-9H,1-2H3 |
| InChIKey | CWAKDFQSGRRJBS-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |