C13H7F5O — CID 22355337
1,2-difluoro-3-[3-(trifluoromethoxy)phenyl]benzene (PubChem CID 22355337) has the molecular formula C13H7F5O and a molecular weight of 274.19 g/mol. Its IUPAC name is 1,2-difluoro-3-[3-(trifluoromethoxy)phenyl]benzene.
| Compound Name | 1,2-difluoro-3-[3-(trifluoromethoxy)phenyl]benzene |
|---|---|
| PubChem CID | 22355337 |
| Molecular Formula | C13H7F5O |
| Molecular Weight | 274.19 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 1,2-difluoro-3-[3-(trifluoromethoxy)phenyl]benzene |
| SMILES | Fc1cccc(-c2cccc(OC(F)(F)F)c2)c1F |
| InChI | InChI=1S/C13H7F5O/c14-11-6-2-5-10(12(11)15)8-3-1-4-9(7-8)19-13(16,17)18/h1-7H |
| InChIKey | YZLIOWYFMMRVAB-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.19 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |