C13H6Cl3F3O — CID 118994485
1,2,4-trichloro-5-[3-(trifluoromethoxy)phenyl]benzene (PubChem CID 118994485) has the molecular formula C13H6Cl3F3O and a molecular weight of 341.54 g/mol. Its IUPAC name is 1,2,4-trichloro-5-[3-(trifluoromethoxy)phenyl]benzene.
| Compound Name | 1,2,4-trichloro-5-[3-(trifluoromethoxy)phenyl]benzene |
|---|---|
| PubChem CID | 118994485 |
| Molecular Formula | C13H6Cl3F3O |
| Molecular Weight | 341.54 g/mol |
| Exact Mass | 339.94 |
| IUPAC Name | 1,2,4-trichloro-5-[3-(trifluoromethoxy)phenyl]benzene |
| SMILES | FC(F)(F)Oc1cccc(-c2cc(Cl)c(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C13H6Cl3F3O/c14-10-6-12(16)11(15)5-9(10)7-2-1-3-8(4-7)20-13(17,18)19/h1-6H |
| InChIKey | LWNXSLJERGGNEG-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.54 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|