C13H5Cl4F3O — CID 119003676
1,2,4-trichloro-5-[2-chloro-5-(trifluoromethoxy)phenyl]benzene (PubChem CID 119003676) has the molecular formula C13H5Cl4F3O and a molecular weight of 375.99 g/mol. Its IUPAC name is 1,2,4-trichloro-5-[2-chloro-5-(trifluoromethoxy)phenyl]benzene.
| Compound Name | 1,2,4-trichloro-5-[2-chloro-5-(trifluoromethoxy)phenyl]benzene |
|---|---|
| PubChem CID | 119003676 |
| Molecular Formula | C13H5Cl4F3O |
| Molecular Weight | 375.99 g/mol |
| Exact Mass | 373.90 |
| IUPAC Name | 1,2,4-trichloro-5-[2-chloro-5-(trifluoromethoxy)phenyl]benzene |
| SMILES | FC(F)(F)Oc1ccc(Cl)c(-c2cc(Cl)c(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C13H5Cl4F3O/c14-9-2-1-6(21-13(18,19)20)3-7(9)8-4-11(16)12(17)5-10(8)15/h1-5H |
| InChIKey | IDJVVUTTWKKKLO-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.99 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|