C21H15F6NO2 — CID 23628482
4-methyl-2,6-bis[3-(trifluoromethoxy)phenyl]aniline (PubChem CID 23628482) has the molecular formula C21H15F6NO2 and a molecular weight of 427.34 g/mol. Its IUPAC name is 4-methyl-2,6-bis[3-(trifluoromethoxy)phenyl]aniline.
| Compound Name | 4-methyl-2,6-bis[3-(trifluoromethoxy)phenyl]aniline |
|---|---|
| PubChem CID | 23628482 |
| Molecular Formula | C21H15F6NO2 |
| Molecular Weight | 427.34 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 4-methyl-2,6-bis[3-(trifluoromethoxy)phenyl]aniline |
| SMILES | Cc1cc(-c2cccc(OC(F)(F)F)c2)c(N)c(-c2cccc(OC(F)(F)F)c2)c1 |
| InChI | InChI=1S/C21H15F6NO2/c1-12-8-17(13-4-2-6-15(10-13)29-20(22,23)24)19(28)18(9-12)14-5-3-7-16(11-14)30-21(25,26)27/h2-11H,28H2,1H3 |
| InChIKey | KSLAONXRBRTYPJ-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.34 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|