C18H19N — CID 175360237
azane;2-(2,3-dimethylphenyl)naphthalene (PubChem CID 175360237) has the molecular formula C18H19N and a molecular weight of 249.36 g/mol. Its IUPAC name is azane;2-(2,3-dimethylphenyl)naphthalene.
| Compound Name | azane;2-(2,3-dimethylphenyl)naphthalene |
|---|---|
| PubChem CID | 175360237 |
| Molecular Formula | C18H19N |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | azane;2-(2,3-dimethylphenyl)naphthalene |
| SMILES | Cc1cccc(-c2ccc3ccccc3c2)c1C.N |
| InChI | InChI=1S/C18H16.H3N/c1-13-6-5-9-18(14(13)2)17-11-10-15-7-3-4-8-16(15)12-17;/h3-12H,1-2H3;1H3 |
| InChIKey | GAIZGQHIQRQASC-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |