C20H20 — CID 90733282
2-(2,3,5,6-tetramethylphenyl)naphthalene (PubChem CID 90733282) has the molecular formula C20H20 and a molecular weight of 260.38 g/mol. Its IUPAC name is 2-(2,3,5,6-tetramethylphenyl)naphthalene.
| Compound Name | 2-(2,3,5,6-tetramethylphenyl)naphthalene |
|---|---|
| PubChem CID | 90733282 |
| Molecular Formula | C20H20 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 2-(2,3,5,6-tetramethylphenyl)naphthalene |
| SMILES | Cc1cc(C)c(C)c(-c2ccc3ccccc3c2)c1C |
| InChI | InChI=1S/C20H20/c1-13-11-14(2)16(4)20(15(13)3)19-10-9-17-7-5-6-8-18(17)12-19/h5-12H,1-4H3 |
| InChIKey | WDBZIPJPADXYOM-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |