C21H20O — CID 173306181
2-methoxy-1,4-dimethyl-3,5-diphenylbenzene (PubChem CID 173306181) has the molecular formula C21H20O and a molecular weight of 288.39 g/mol. Its IUPAC name is 2-methoxy-1,4-dimethyl-3,5-diphenylbenzene.
| Compound Name | 2-methoxy-1,4-dimethyl-3,5-diphenylbenzene |
|---|---|
| PubChem CID | 173306181 |
| Molecular Formula | C21H20O |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 2-methoxy-1,4-dimethyl-3,5-diphenylbenzene |
| SMILES | COc1c(C)cc(-c2ccccc2)c(C)c1-c1ccccc1 |
| InChI | InChI=1S/C21H20O/c1-15-14-19(17-10-6-4-7-11-17)16(2)20(21(15)22-3)18-12-8-5-9-13-18/h4-14H,1-3H3 |
| InChIKey | UPQUUKMFHIMYFZ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |