C20H18O — CID 20717375
1-methoxy-4-methyl-2,5-diphenylbenzene (PubChem CID 20717375) has the molecular formula C20H18O and a molecular weight of 274.36 g/mol. Its IUPAC name is 1-methoxy-4-methyl-2,5-diphenylbenzene.
| Compound Name | 1-methoxy-4-methyl-2,5-diphenylbenzene |
|---|---|
| PubChem CID | 20717375 |
| Molecular Formula | C20H18O |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 1-methoxy-4-methyl-2,5-diphenylbenzene |
| SMILES | COc1cc(-c2ccccc2)c(C)cc1-c1ccccc1 |
| InChI | InChI=1S/C20H18O/c1-15-13-19(17-11-7-4-8-12-17)20(21-2)14-18(15)16-9-5-3-6-10-16/h3-14H,1-2H3 |
| InChIKey | AIGUTDZPVFWVBY-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |