C24H26O2 — CID 156631925
1,4-bis(2,6-dimethylphenyl)-2,5-dimethoxybenzene (PubChem CID 156631925) has the molecular formula C24H26O2 and a molecular weight of 346.47 g/mol. Its IUPAC name is 1,4-bis(2,6-dimethylphenyl)-2,5-dimethoxybenzene.
| Compound Name | 1,4-bis(2,6-dimethylphenyl)-2,5-dimethoxybenzene |
|---|---|
| PubChem CID | 156631925 |
| Molecular Formula | C24H26O2 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 1,4-bis(2,6-dimethylphenyl)-2,5-dimethoxybenzene |
| SMILES | COc1cc(-c2c(C)cccc2C)c(OC)cc1-c1c(C)cccc1C |
| InChI | InChI=1S/C24H26O2/c1-15-9-7-10-16(2)23(15)19-13-22(26-6)20(14-21(19)25-5)24-17(3)11-8-12-18(24)4/h7-14H,1-6H3 |
| InChIKey | MNKAXMJUVWXFCI-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |