C24H25LiO2 — CID 166514552
lithium 1,5-bis(2,6-dimethylphenyl)-2,4-dimethoxybenzene-3-ide (PubChem CID 166514552) has the molecular formula C24H25LiO2 and a molecular weight of 352.40 g/mol. Its IUPAC name is lithium 1,5-bis(2,6-dimethylphenyl)-2,4-dimethoxybenzene-3-ide.
| Compound Name | lithium 1,5-bis(2,6-dimethylphenyl)-2,4-dimethoxybenzene-3-ide |
|---|---|
| PubChem CID | 166514552 |
| Molecular Formula | C24H25LiO2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | lithium 1,5-bis(2,6-dimethylphenyl)-2,4-dimethoxybenzene-3-ide |
| SMILES | COc1[c-]c(OC)c(-c2c(C)cccc2C)cc1-c1c(C)cccc1C.[Li+] |
| InChI | InChI=1S/C24H25O2.Li/c1-15-9-7-10-16(2)23(15)19-13-20(22(26-6)14-21(19)25-5)24-17(3)11-8-12-18(24)4;/h7-13H,1-6H3;/q-1;+1 |
| InChIKey | IJRXHPYJTCBOKU-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|