C15H15BrO — CID 83666215
1-(4-bromophenyl)-2-methoxy-4,5-dimethylbenzene (PubChem CID 83666215) has the molecular formula C15H15BrO and a molecular weight of 291.19 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2-methoxy-4,5-dimethylbenzene.
| Compound Name | 1-(4-bromophenyl)-2-methoxy-4,5-dimethylbenzene |
|---|---|
| PubChem CID | 83666215 |
| Molecular Formula | C15H15BrO |
| Molecular Weight | 291.19 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 1-(4-bromophenyl)-2-methoxy-4,5-dimethylbenzene |
| SMILES | COc1cc(C)c(C)cc1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H15BrO/c1-10-8-14(15(17-3)9-11(10)2)12-4-6-13(16)7-5-12/h4-9H,1-3H3 |
| InChIKey | BLBBDPOSOLFFGO-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.19 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |