C13H13BrN2O — CID 82094371
3-bromo-6-(2-methoxy-4,5-dimethylphenyl)pyridazine (PubChem CID 82094371) has the molecular formula C13H13BrN2O and a molecular weight of 293.16 g/mol. Its IUPAC name is 3-bromo-6-(2-methoxy-4,5-dimethylphenyl)pyridazine.
| Compound Name | 3-bromo-6-(2-methoxy-4,5-dimethylphenyl)pyridazine |
|---|---|
| PubChem CID | 82094371 |
| Molecular Formula | C13H13BrN2O |
| Molecular Weight | 293.16 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | 3-bromo-6-(2-methoxy-4,5-dimethylphenyl)pyridazine |
| SMILES | COc1cc(C)c(C)cc1-c1ccc(Br)nn1 |
| InChI | InChI=1S/C13H13BrN2O/c1-8-6-10(12(17-3)7-9(8)2)11-4-5-13(14)16-15-11/h4-7H,1-3H3 |
| InChIKey | ZUFANSHQGHBLBN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.16 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |