About 2-bromo-5-(2-methoxy-4,5-dimethylphenyl)-1H-imidazole
2-bromo-5-(2-methoxy-4,5-dimethylphenyl)-1H-imidazole (PubChem CID 116884250) has the molecular formula C12H13BrN2O
and a molecular weight of 281.15 g/mol. Its IUPAC name is 2-bromo-5-(2-methoxy-4,5-dimethylphenyl)-1H-imidazole.
Molecular Properties
| Compound Name | 2-bromo-5-(2-methoxy-4,5-dimethylphenyl)-1H-imidazole |
| PubChem CID | 116884250 |
| Molecular Formula | C12H13BrN2O |
| Molecular Weight | 281.15 g/mol |
| Exact Mass | 280.02 |
| IUPAC Name | 2-bromo-5-(2-methoxy-4,5-dimethylphenyl)-1H-imidazole |
| SMILES | COc1cc(C)c(C)cc1-c1cnc(Br)[nH]1 |
| InChI | InChI=1S/C12H13BrN2O/c1-7-4-9(10-6-14-12(13)15-10)11(16-3)5-8(7)2/h4-6H,1-3H3,(H,14,15) |
| InChIKey | DPYZENCYWBKNEI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.15 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-bromo-5-(2-methoxy-4,5-dimethylphenyl)-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5-(2-methoxy-4,5-dimethylphenyl)-1H-imidazole?
The IUPAC name of 2-bromo-5-(2-methoxy-4,5-dimethylphenyl)-1H-imidazole (CID 116884250) is 2-bromo-5-(2-methoxy-4,5-dimethylphenyl)-1H-imidazole.
What is the SMILES notation for 2-bromo-5-(2-methoxy-4,5-dimethylphenyl)-1H-imidazole?
The canonical SMILES for 2-bromo-5-(2-methoxy-4,5-dimethylphenyl)-1H-imidazole is COc1cc(C)c(C)cc1-c1cnc(Br)[nH]1.
What is the InChIKey of 2-bromo-5-(2-methoxy-4,5-dimethylphenyl)-1H-imidazole?
The InChIKey is DPYZENCYWBKNEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13BrN2O/c1-7-4-9(10-6-14-12(13)15-10)11(16-3)5-8(7)2/h4-6H,1-3H3,(H,14,15).
What are the key properties of 2-bromo-5-(2-methoxy-4,5-dimethylphenyl)-1H-imidazole?
2-bromo-5-(2-methoxy-4,5-dimethylphenyl)-1H-imidazole has a molecular weight of 281.15 g/mol, XLogP of 3.46, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-(2-methoxy-4,5-dimethylphenyl)-1H-imidazole is sourced from PubChem (CID 116884250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).