C13H17N3O2 — CID 116879386
5-(2,5-dimethoxy-3,4-dimethylphenyl)-1H-imidazol-2-amine (PubChem CID 116879386) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 5-(2,5-dimethoxy-3,4-dimethylphenyl)-1H-imidazol-2-amine.
| Compound Name | 5-(2,5-dimethoxy-3,4-dimethylphenyl)-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 116879386 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 5-(2,5-dimethoxy-3,4-dimethylphenyl)-1H-imidazol-2-amine |
| SMILES | COc1cc(-c2cnc(N)[nH]2)c(OC)c(C)c1C |
| InChI | InChI=1S/C13H17N3O2/c1-7-8(2)12(18-4)9(5-11(7)17-3)10-6-15-13(14)16-10/h5-6H,1-4H3,(H3,14,15,16) |
| InChIKey | CXQMVSJVARPEPY-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |