5-(2,4-dimethoxy-3-methylphenyl)-1H-imidazole-2-carboxylic acid

C13H14N2O4 — CID 116878527

IUPAC5-(2,4-dimethoxy-3-methylphenyl)-1H-imidazole-2-carboxylic acid
SMILESCOc1ccc(-c2cnc(C(=O)O)[nH]2)c(OC)c1C
InChIInChI=1S/C13H14N2O4/c1-7-10(18-2)5-4-8(11(7)19-3)9-6-14-12(15-9)13(16)17/h4-6H,1-3H3,(H,14,15)(H,16,17)
InChIKeyHHIVGUHQKWAXQT-UHFFFAOYSA-N
MW262.26 g/mol
LogP2.10
Rot. Bonds4

About 5-(2,4-dimethoxy-3-methylphenyl)-1H-imidazole-2-carboxylic acid

5-(2,4-dimethoxy-3-methylphenyl)-1H-imidazole-2-carboxylic acid (PubChem CID 116878527) has the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is 5-(2,4-dimethoxy-3-methylphenyl)-1H-imidazole-2-carboxylic acid.

Molecular Properties

Compound Name5-(2,4-dimethoxy-3-methylphenyl)-1H-imidazole-2-carboxylic acid
PubChem CID116878527
Molecular FormulaC13H14N2O4
Molecular Weight262.26 g/mol
Exact Mass262.10
IUPAC Name5-(2,4-dimethoxy-3-methylphenyl)-1H-imidazole-2-carboxylic acid
SMILESCOc1ccc(-c2cnc(C(=O)O)[nH]2)c(OC)c1C
InChIInChI=1S/C13H14N2O4/c1-7-10(18-2)5-4-8(11(7)19-3)9-6-14-12(15-9)13(16)17/h4-6H,1-3H3,(H,14,15)(H,16,17)
InChIKeyHHIVGUHQKWAXQT-UHFFFAOYSA-N
XLogP2.10
TPSA84.44 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.26
LogP ≤ 52.10
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 5-(2,4-dimethoxy-3-methylphenyl)-1H-imidazole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(2,4-dimethoxy-3-methylphenyl)-1H-imidazole-2-carboxylic acid?
The IUPAC name of 5-(2,4-dimethoxy-3-methylphenyl)-1H-imidazole-2-carboxylic acid (CID 116878527) is 5-(2,4-dimethoxy-3-methylphenyl)-1H-imidazole-2-carboxylic acid.
What is the SMILES notation for 5-(2,4-dimethoxy-3-methylphenyl)-1H-imidazole-2-carboxylic acid?
The canonical SMILES for 5-(2,4-dimethoxy-3-methylphenyl)-1H-imidazole-2-carboxylic acid is COc1ccc(-c2cnc(C(=O)O)[nH]2)c(OC)c1C.
What is the InChIKey of 5-(2,4-dimethoxy-3-methylphenyl)-1H-imidazole-2-carboxylic acid?
The InChIKey is HHIVGUHQKWAXQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O4/c1-7-10(18-2)5-4-8(11(7)19-3)9-6-14-12(15-9)13(16)17/h4-6H,1-3H3,(H,14,15)(H,16,17).
What are the key properties of 5-(2,4-dimethoxy-3-methylphenyl)-1H-imidazole-2-carboxylic acid?
5-(2,4-dimethoxy-3-methylphenyl)-1H-imidazole-2-carboxylic acid has a molecular weight of 262.26 g/mol, XLogP of 2.10, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,4-dimethoxy-3-methylphenyl)-1H-imidazole-2-carboxylic acid is sourced from PubChem (CID 116878527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).