C14H18N2O3 — CID 116878374
2-[5-(2,4-dimethoxy-3-methylphenyl)-1H-imidazol-2-yl]ethanol (PubChem CID 116878374) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is 2-[5-(2,4-dimethoxy-3-methylphenyl)-1H-imidazol-2-yl]ethanol.
| Compound Name | 2-[5-(2,4-dimethoxy-3-methylphenyl)-1H-imidazol-2-yl]ethanol |
|---|---|
| PubChem CID | 116878374 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 2-[5-(2,4-dimethoxy-3-methylphenyl)-1H-imidazol-2-yl]ethanol |
| SMILES | COc1ccc(-c2cnc(CCO)[nH]2)c(OC)c1C |
| InChI | InChI=1S/C14H18N2O3/c1-9-12(18-2)5-4-10(14(9)19-3)11-8-15-13(16-11)6-7-17/h4-5,8,17H,6-7H2,1-3H3,(H,15,16) |
| InChIKey | YBXCVIGEWKYUJW-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 67.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |