C11H10FN3O2 — CID 116883943
5-(5-fluoro-2-methoxyphenyl)-1H-imidazole-2-carboxamide (PubChem CID 116883943) has the molecular formula C11H10FN3O2 and a molecular weight of 235.22 g/mol. Its IUPAC name is 5-(5-fluoro-2-methoxyphenyl)-1H-imidazole-2-carboxamide.
| Compound Name | 5-(5-fluoro-2-methoxyphenyl)-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 116883943 |
| Molecular Formula | C11H10FN3O2 |
| Molecular Weight | 235.22 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 5-(5-fluoro-2-methoxyphenyl)-1H-imidazole-2-carboxamide |
| SMILES | COc1ccc(F)cc1-c1cnc(C(N)=O)[nH]1 |
| InChI | InChI=1S/C11H10FN3O2/c1-17-9-3-2-6(12)4-7(9)8-5-14-11(15-8)10(13)16/h2-5H,1H3,(H2,13,16)(H,14,15) |
| InChIKey | ZRHJOYKORRBWND-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.22 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |