C13H10FNO3S — CID 94287740
6-(5-fluoro-2-methoxyphenyl)-2-sulfanylidene-1H-pyridine-3-carboxylic acid (PubChem CID 94287740) has the molecular formula C13H10FNO3S and a molecular weight of 279.29 g/mol. Its IUPAC name is 6-(5-fluoro-2-methoxyphenyl)-2-sulfanylidene-1H-pyridine-3-carboxylic acid.
| Compound Name | 6-(5-fluoro-2-methoxyphenyl)-2-sulfanylidene-1H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 94287740 |
| Molecular Formula | C13H10FNO3S |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | 6-(5-fluoro-2-methoxyphenyl)-2-sulfanylidene-1H-pyridine-3-carboxylic acid |
| SMILES | COc1ccc(F)cc1-c1ccc(C(=O)O)c(=S)[nH]1 |
| InChI | InChI=1S/C13H10FNO3S/c1-18-11-5-2-7(14)6-9(11)10-4-3-8(13(16)17)12(19)15-10/h2-6H,1H3,(H,15,19)(H,16,17) |
| InChIKey | IVOFDCPPIRWDIY-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|