C11H9FN2O3S — CID 116824039
5-(5-fluoro-2-methoxyphenyl)-2-sulfanylidene-1,3-dihydroimidazole-4-carboxylic acid (PubChem CID 116824039) has the molecular formula C11H9FN2O3S and a molecular weight of 268.27 g/mol. Its IUPAC name is 5-(5-fluoro-2-methoxyphenyl)-2-sulfanylidene-1,3-dihydroimidazole-4-carboxylic acid.
| Compound Name | 5-(5-fluoro-2-methoxyphenyl)-2-sulfanylidene-1,3-dihydroimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 116824039 |
| Molecular Formula | C11H9FN2O3S |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 5-(5-fluoro-2-methoxyphenyl)-2-sulfanylidene-1,3-dihydroimidazole-4-carboxylic acid |
| SMILES | COc1ccc(F)cc1-c1[nH]c(=S)[nH]c1C(=O)O |
| InChI | InChI=1S/C11H9FN2O3S/c1-17-7-3-2-5(12)4-6(7)8-9(10(15)16)14-11(18)13-8/h2-4H,1H3,(H,15,16)(H2,13,14,18) |
| InChIKey | XGICXTATLWWPPF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 78.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|