C15H17FN2OS — CID 106518318
6-(5-fluoro-2-methoxyphenyl)-5-methyl-2-propan-2-yl-1H-pyrimidine-4-thione (PubChem CID 106518318) has the molecular formula C15H17FN2OS and a molecular weight of 292.38 g/mol. Its IUPAC name is 6-(5-fluoro-2-methoxyphenyl)-5-methyl-2-propan-2-yl-1H-pyrimidine-4-thione.
| Compound Name | 6-(5-fluoro-2-methoxyphenyl)-5-methyl-2-propan-2-yl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106518318 |
| Molecular Formula | C15H17FN2OS |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 6-(5-fluoro-2-methoxyphenyl)-5-methyl-2-propan-2-yl-1H-pyrimidine-4-thione |
| SMILES | COc1ccc(F)cc1-c1[nH]c(C(C)C)nc(=S)c1C |
| InChI | InChI=1S/C15H17FN2OS/c1-8(2)14-17-13(9(3)15(20)18-14)11-7-10(16)5-6-12(11)19-4/h5-8H,1-4H3,(H,17,18,20) |
| InChIKey | WHPBKYZABVTMNF-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|